Aminobenzoic acids and derivatives
Medchemexpress LLC Ac-YVAD-cmk | 178603-78-6 | 98.9% | 540.99 | 5 MG
Ac-YVAD-cmk (Caspase-1 Inhibitor II) is a selective caspase-1 (IL-1beta converting enzyme, ICE) inhibitor. It exhibits neuroprotective and anti-inflammatory effects by effectively suppressing the expression of IL-1β and IL-18, and inhibits pyroptosis in various diseases.
- Selective caspase-1 (ICE) inhibitor
- Exhibits neuroprotective effects
- Offers anti-inflammatory properties
- Suppresses IL-1β and IL-18 expression
- Inhibits pyroptosis
- For research use only
Alkali Scientific Coenzyme A, Free Acid, 10 Mg
Coenzyme A (Free Acid) is a high-purity biochemical reagent used in metabolic and biochemical assays. It serves as a vital coenzyme in various biochemical reactions, including the synthesis and breakdown of fatty acids and the production of acetyl-CoA, a critical molecule in the citric acid cycle. This 10 mg product is ideal for small-scale laboratory experiments and enzymatic assays. Coenzyme A is widely used in research focused on cellular metabolism, energy production, and lipid metabolism. It is crucial for studies in enzymology, pharmaceutical development, and metabolic disease research, providing a reliable tool for accurate biochemical analysis.
eMolecules 59107-51-6 | 1-Amino-8-chloronaphthalene | Accela ChemBio (ASD) | MFCD00465087 | 177.630 | C10H8ClN | 98.000 | Nc1cccc2cccc(Cl)c12 | 100g | 705600125
1-Amino-8-chloronaphthalene | Accela ChemBio (ASD) | 59107-51-6 | MFCD00465087 | 177.630 | C10H8ClN | 98.000 | Nc1cccc2cccc(Cl)c12 | 100g | 705600125
eMolecules 83249-10-9 | 3-(Methoxycarbonyl)bicyclo[1.1.1]pentane-1-carboxylic acid | Combi-Blocks, Inc. | MFCD20638314 | 170.164 | C8H10O4 | 98.000 | COC(=O)C12CC(C1)(C2)C(O)=O | 25g | 589787368
3-(Methoxycarbonyl)bicyclo[1.1.1]pentane-1-carboxylic acid | Combi-Blocks, Inc. | 83249-10-9 | MFCD20638314 | 170.164 | C8H10O4 | 98.000 | COC(=O)C12CC(C1)(C2)C(O)=O | 25g | 589787368
eMolecules 55750-61-3 | a-Maleimidoacetic acid-NHS | Chem-Impex | MFCD00133523 | 252.182 | C10H8N2O6 | 98.000 | O=C(CN1C(=O)C=CC1=O)ON1C(=O)CCC1=O | 25mg | 272386872
a-Maleimidoacetic acid-NHS | Chem-Impex | 55750-61-3 | MFCD00133523 | 252.182 | C10H8N2O6 | 98.000 | O=C(CN1C(=O)C=CC1=O)ON1C(=O)CCC1=O | 25mg | 272386872
eMolecules 89466-08-0 | 2-Hydroxybenzeneboronic acid | Apollo Scientific US - Building Blocks | MFCD01074581 | 137.930 | C6H7BO3 | 95.000 | OB(O)c1ccccc1O | 100g | 404236667
2-Hydroxybenzeneboronic acid | Apollo Scientific US - Building Blocks | 89466-08-0 | MFCD01074581 | 137.930 | C6H7BO3 | 95.000 | OB(O)c1ccccc1O | 100g | 404236667
eMolecules 3132-64-7 | Epibromohydrin | Oakwood Chemical | MFCD00005130 | 136.976 | C3H5BrO | 98.000 | BrCC1CO1 | 25g | 533803802
Epibromohydrin | Oakwood Chemical | 3132-64-7 | MFCD00005130 | 136.976 | C3H5BrO | 98.000 | BrCC1CO1 | 25g | 533803802
eMolecules 39161-84-7 | 4-Mercaptophenylacetic acid | Ambeed | MFCD00797617 | 168.210 | C8H8O2S | 97.000 | OC(=O)Cc1ccc(S)cc1 | 100g | 874846329
4-Mercaptophenylacetic acid | Ambeed | 39161-84-7 | MFCD00797617 | 168.210 | C8H8O2S | 97.000 | OC(=O)Cc1ccc(S)cc1 | 100g | 874846329
eMolecules 867062-95-1 | Fmoc-12-amino-4,7,10-trioxadodecanoic acid | Combi-Blocks, Inc. | MFCD06656471 | 443.496 | C24H29NO7 | 97.000 | OC(=O)CCOCCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc12 | 100g | 837472633
Fmoc-12-amino-4,7,10-trioxadodecanoic acid | Combi-Blocks, Inc. | 867062-95-1 | MFCD06656471 | 443.496 | C24H29NO7 | 97.000 | OC(=O)CCOCCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc12 | 100g | 837472633
eMolecules 867062-95-1 | Fmoc-NH-PEG3-CH2CH2COOH | AA Blocks LLC | MFCD06656471 | 443.496 | C24H29NO7 | 0.000 | OC(=O)CCOCCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc12 | 10g | 410184290
Fmoc-NH-PEG3-CH2CH2COOH | AA Blocks LLC | 867062-95-1 | MFCD06656471 | 443.496 | C24H29NO7 | 0.000 | OC(=O)CCOCCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc12 | 10g | 410184290
eMolecules 474330-54-6 | 5-Amino-2-bromo-4-methyl-benzoic acid methyl ester | Chemcia | MFCD14706185 | 244.088 | C9H10BrNO2 | 97.000 | COC(=O)c1cc(N)c(C)cc1Br | 5g | 248488793
5-Amino-2-bromo-4-methyl-benzoic acid methyl ester | Chemcia | 474330-54-6 | MFCD14706185 | 244.088 | C9H10BrNO2 | 97.000 | COC(=O)c1cc(N)c(C)cc1Br | 5g | 248488793
eMolecules 492-88-6 | 3-Ethoxysalicylaldehyde | Ambeed | MFCD00003323 | 166.176 | C9H10O3 | 97.000 | CCOc1cccc(C=O)c1O | 100g | 572838756
3-Ethoxysalicylaldehyde | Ambeed | 492-88-6 | MFCD00003323 | 166.176 | C9H10O3 | 97.000 | CCOc1cccc(C=O)c1O | 100g | 572838756
eMolecules 77-86-1 | 2-amino-2-(hydroxymethyl)propane-1,3-diol | Key Organics/BIONET | MFCD00004679 | 121.136 | C4H11NO3 | 95.000 | NC(CO)(CO)CO | 25mg | 564371332
2-amino-2-(hydroxymethyl)propane-1,3-diol | Key Organics/BIONET | 77-86-1 | MFCD00004679 | 121.136 | C4H11NO3 | 95.000 | NC(CO)(CO)CO | 25mg | 564371332
eMolecules 823-58-5 | 4-Amino-3,6-dichloropyridazine | Apollo Scientific | MFCD01647253 | 163.990 | C4H3Cl2N3 | 97.000 | Nc1cc(Cl)nnc1Cl | 25g | 600855069
4-Amino-3,6-dichloropyridazine | Apollo Scientific | 823-58-5 | MFCD01647253 | 163.990 | C4H3Cl2N3 | 97.000 | Nc1cc(Cl)nnc1Cl | 25g | 600855069
NC(=O)OC(C)(C)C | 100g | 672523623](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000280395.jpg-250.jpg)
eMolecules 328086-60-8 | Paxlovid Intermediate 3 | Ambeed | MFCD28138267 | 286.328 | C13H22N2O5 | 97.000 | COC(=O)[C@H](C[C@@H]1CCNC1=O)NC(=O)OC(C)(C)C | 100g | 672523623
Paxlovid Intermediate 3 | Ambeed | 328086-60-8 | MFCD28138267 | 286.328 | C13H22N2O5 | 97.000 | COC(=O)[C@H](C[C@@H]1CCNC1=O)NC(=O)OC(C)(C)C | 100g | 672523623